|
CAS#: 18780-96-6 Product: 1-[4-Hydroxy-2,6-Dimethoxy-3-(3-Methyl-2-Buten-1-Yl)Phenyl]Ethanone No suppilers available for the product. |
| Name | 1-[4-Hydroxy-2,6-Dimethoxy-3-(3-Methyl-2-Buten-1-Yl)Phenyl]Ethanone |
|---|---|
| Synonyms | 1-[4-Hydr |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 18780-96-6 |
| SMILES | O=C(c1c(OC)cc(O)c(c1OC)C/C=C(\C)C)C |
| InChI | 1S/C15H20O4/c1-9(2)6-7-11-12(17)8-13(18-4)14(10(3)16)15(11)19-5/h6,8,17H,7H2,1-5H3 |
| InChIKey | KELHULRTPVJHMF-UHFFFAOYSA-N |
| Density | 1.087g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.947°C at 760 mmHg (Cal.) |
| Flash point | 155.099°C (Cal.) |
| Refractive index | 1.528 (Cal.) |
| (1) | Cardillo G., Cricchio R., Merlini L.. Synthesis of d,l-cannabichromene, franklinone and other natural chromenes☆, Tetrahedron, 1968 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-[4-Hydroxy-2,6-Dimethoxy-3-(3-Methyl-2-Buten-1-Yl)Phenyl]Ethanone |