|
CAS#: 18825-03-1 Product: 1,3-Dichloro-1,1,3,3-Tetraethyldisiloxane No suppilers available for the product. |
| Name | 1,3-Dichloro-1,1,3,3-Tetraethyldisiloxane |
|---|---|
| Synonyms | 1,3-Dichlorotetraethyldisiloxane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H20Cl2OSi2 |
| Molecular Weight | 259.32 |
| CAS Registry Number | 18825-03-1 |
| SMILES | CC[Si](Cl)(CC)O[Si](Cl)(CC)CC |
| InChI | 1S/C8H20Cl2OSi2/c1-5-12(9,6-2)11-13(10,7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | ZXLGILKATDDQDX-UHFFFAOYSA-N |
| Density | 0.993g/cm3 (Cal.) |
|---|---|
| Boiling point | 224.593°C at 760 mmHg (Cal.) |
| Flash point | 75.733°C (Cal.) |
| Refractive index | 1.433 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichloro-1,1,3,3-Tetraethyldisiloxane |