|
CAS#: 18833-50-6 Product: 5,6,7,8,9,10-Hexahydro-2-Chloro-11H-Cyclohepta[b]Quinoline-11-Thione No suppilers available for the product. |
| Name | 5,6,7,8,9,10-Hexahydro-2-Chloro-11H-Cyclohepta[b]Quinoline-11-Thione |
|---|---|
| Synonyms | 11H-Cyclohepta(B)Quinoline-11-Thione, 5,6,7,8,9,10-Hexahydro-2-Chloro-; 2-Chloro-5,6,7,8,9,10-Hexahydro-11H-Cyclohepta(B)Quinoline-11-Thione; Brn 1460876 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14ClNS |
| Molecular Weight | 263.78 |
| CAS Registry Number | 18833-50-6 |
| SMILES | C1=C(C=CC2=C1C(C3=C(N2)CCCCC3)=S)Cl |
| InChI | 1S/C14H14ClNS/c15-9-6-7-13-11(8-9)14(17)10-4-2-1-3-5-12(10)16-13/h6-8H,1-5H2,(H,16,17) |
| InChIKey | URSHSEXDRVGWQT-UHFFFAOYSA-N |
| Density | 1.316g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.916°C at 760 mmHg (Cal.) |
| Flash point | 193.848°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,7,8,9,10-Hexahydro-2-Chloro-11H-Cyclohepta[b]Quinoline-11-Thione |