|
CAS#: 188359-22-0 Product: 2-Methyl-L-Alloisoleucine No suppilers available for the product. |
| Name | 2-Methyl-L-Alloisoleucine |
|---|---|
| Synonyms | (2S,3R)-2-amino-2,3-dimethylpentanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 |
| CAS Registry Number | 188359-22-0 |
| SMILES | CC[C@@H](C)[C@@](C)(C(=O)O)N |
| InChI | 1S/C7H15NO2/c1-4-5(2)7(3,8)6(9)10/h5H,4,8H2,1-3H3,(H,9,10)/t5-,7+/m1/s1 |
| InChIKey | RSPOGBIHKNKRFJ-VDTYLAMSSA-N |
| Density | 1.017g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.005°C at 760 mmHg (Cal.) |
| Flash point | 96.533°C (Cal.) |
| Refractive index | 1.465 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-L-Alloisoleucine |