|
CAS#: 18845-23-3 Product: 6-Bromo-5-Chloro-3-(3-Chloropropyl)-2-Benzoxazolinone No suppilers available for the product. |
| Name | 6-Bromo-5-Chloro-3-(3-Chloropropyl)-2-Benzoxazolinone |
|---|---|
| Synonyms | 2-Benzoxazolinone, 6-Bromo-5-Chloro-3-(3-Chloropropyl)-; 6-Bromo-5-Chloro-3-(3-Chloropropyl)-2-Benzoxazolinone; Brn 1217205 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8BrCl2NO2 |
| Molecular Weight | 324.99 |
| CAS Registry Number | 18845-23-3 |
| SMILES | C2=C1N(C(OC1=CC(=C2Cl)Br)=O)CCCCl |
| InChI | 1S/C10H8BrCl2NO2/c11-6-4-9-8(5-7(6)13)14(3-1-2-12)10(15)16-9/h4-5H,1-3H2 |
| InChIKey | MAWIJICIKRZZIT-UHFFFAOYSA-N |
| Density | 1.704g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.734°C at 760 mmHg (Cal.) |
| Flash point | 211.277°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Bromo-5-Chloro-3-(3-Chloropropyl)-2-Benzoxazolinone |