|
CAS#: 188524-66-5 Product: Methyl 4-(4-Methylphenyl)-1H-Pyrrole-3-Carboxylate No suppilers available for the product. |
| Name | Methyl 4-(4-Methylphenyl)-1H-Pyrrole-3-Carboxylate |
|---|---|
| Synonyms | methyl 4-(4-methylphenyl)-1H-pyrrole-3-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 |
| CAS Registry Number | 188524-66-5 |
| SMILES | O=C(OC)c2c(c1ccc(cc1)C)cnc2 |
| InChI | 1S/C13H13NO2/c1-9-3-5-10(6-4-9)11-7-14-8-12(11)13(15)16-2/h3-8,14H,1-2H3 |
| InChIKey | HXBXYFBJILFUBH-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.03°C at 760 mmHg (Cal.) |
| Flash point | 211.456°C (Cal.) |
| Refractive index | 1.575 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 4-(4-Methylphenyl)-1H-Pyrrole-3-Carboxylate |