|
CAS#: 18868-66-1 Product: 12-Ethylbenz(a)Anthracene No suppilers available for the product. |
| Name | 12-Ethylbenz(a)Anthracene |
|---|---|
| Synonyms | Ccris 1537; 12-Ethylbenz(A)Anthracene; 3-05-00-02410 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 |
| CAS Registry Number | 18868-66-1 |
| SMILES | C3=CC2=CC1=C(C=CC=C1)C(=C2C4=CC=CC=C34)CC |
| InChI | 1S/C20H16/c1-2-17-18-9-5-4-8-15(18)13-16-12-11-14-7-3-6-10-19(14)20(16)17/h3-13H,2H2,1H3 |
| InChIKey | ZZIFQBYIKWXEHJ-UHFFFAOYSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.196°C at 760 mmHg (Cal.) |
| Flash point | 223.575°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12-Ethylbenz(a)Anthracene |