|
CAS#: 18888-80-7 Product: 1,1'-[1-Cyclohexene-1,2-Diyldi(E)-2,1-Ethenediyl]Dibenzene No suppilers available for the product. |
| Name | 1,1'-[1-Cyclohexene-1,2-Diyldi(E)-2,1-Ethenediyl]Dibenzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.41 |
| CAS Registry Number | 18888-80-7 |
| SMILES | c3(\C=C\C2=C(/C=C/c1ccccc1)CCCC2)ccccc3 |
| InChI | 1S/C22H22/c1-3-9-19(10-4-1)15-17-21-13-7-8-14-22(21)18-16-20-11-5-2-6-12-20/h1-6,9-12,15-18H,7-8,13-14H2/b17-15+,18-16+ |
| InChIKey | AQORHOFLVYNXST-YTEMWHBBSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.29°C at 760 mmHg (Cal.) |
| Flash point | 267.565°C (Cal.) |
| Refractive index | 1.741 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[1-Cyclohexene-1,2-Diyldi(E)-2,1-Ethenediyl]Dibenzene |