|
CAS#: 188956-37-8 Product: (2R,3S)-2,3-Pyrrolidinedicarboxylic Acid No suppilers available for the product. |
| Name | (2R,3S)-2,3-Pyrrolidinedicarboxylic Acid |
|---|---|
| Synonyms | (2R,3S)-Pyrrolidine-2,3-dicarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 |
| CAS Registry Number | 188956-37-8 |
| SMILES | C1CN[C@H]([C@H]1C(=O)O)C(=O)O |
| InChI | 1S/C6H9NO4/c8-5(9)3-1-2-7-4(3)6(10)11/h3-4,7H,1-2H2,(H,8,9)(H,10,11)/t3-,4+/m0/s1 |
| InChIKey | GLQKHRAKKLRGNR-IUYQGCFVSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 208.0±28.7°C (Cal.) |
| Refractive index | 1.535 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3S)-2,3-Pyrrolidinedicarboxylic Acid |