Online Database of Chemicals from Around the World
|
CAS#: 189-58-2 Product: Dinaphtho[1,2,3-de:3',2',1'-ij]phthalazine No suppilers available for the product. |
| Name | Dinaphtho[1,2,3-de:3',2',1'-ij]phthalazine |
|---|---|
| Synonyms | Anthra(9,1,2-Cde)Benzo(H)Cinnoline; Brn 0027200; Dinaphtho(1,2,3-De:3',2',1'-Ij)Phthalazine |
| Molecular Structure | ![CAS#: 189-58-2, Dinaphtho[1,2,3-de:3',2',1'-ij]phthalazine](/moreStructures/189-58-2.gif) |
| Molecular Formula | C22H12N2 |
| Molecular Weight | 304.35 |
| CAS Registry Number | 189-58-2 |
| SMILES | C1=C6C3=C(C2=C1C=CC=C2)N=NC4=C3C(=CC5=CC=CC=C45)C=C6 |
| InChI | 1S/C22H12N2/c1-3-7-17-13(5-1)11-15-9-10-16-12-14-6-2-4-8-18(14)22-20(16)19(15)21(17)23-24-22/h1-12H |
| InChIKey | COEVWYGSNZUYPJ-UHFFFAOYSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.455°C at 760 mmHg (Cal.) |
| Flash point | 139.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dinaphtho[1,2,3-de:3',2',1'-ij]phthalazine |