|
CAS#: 18904-40-0 Product: Acrophylline No suppilers available for the product. |
| Name | Acrophylline |
|---|---|
| Synonyms | 7-Methoxy-9-(3-Methylbut-2-Enyl)-4-Furo[2,3-B]Quinolinone; Acrophylline; C10634 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 |
| CAS Registry Number | 18904-40-0 |
| SMILES | C1=C2C(=CC=C1OC)C(C3=C(N2CC=C(C)C)OC=C3)=O |
| InChI | 1S/C17H17NO3/c1-11(2)6-8-18-15-10-12(20-3)4-5-13(15)16(19)14-7-9-21-17(14)18/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | GARIOWCJZYSSOE-UHFFFAOYSA-N |
| Density | 1.176g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.985°C at 760 mmHg (Cal.) |
| Flash point | 221.105°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acrophylline |