|
CAS#: 189077-34-7 Product: N-[1-Cyclohexyl-2-(Cyclohexylamino)-2-Oxoethyl]-N-Propylbenzamide No suppilers available for the product. |
| Name | N-[1-Cyclohexyl-2-(Cyclohexylamino)-2-Oxoethyl]-N-Propylbenzamide |
|---|---|
| Synonyms | BENZAMIDE |
| Molecular Structure | ![]() |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.55 |
| CAS Registry Number | 189077-34-7 |
| SMILES | O=C(NC1CCCCC1)C(N(C(=O)c2ccccc2)CCC)C3CCCCC3 |
| InChI | 1S/C24H36N2O2/c1-2-18-26(24(28)20-14-8-4-9-15-20)22(19-12-6-3-7-13-19)23(27)25-21-16-10-5-11-17-21/h4,8-9,14-15,19,21-22H,2-3,5-7,10-13,16-18H2,1H3,(H,25,27) |
| InChIKey | HUPPCPXEPRZWSG-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 586.95°C at 760 mmHg (Cal.) |
| Flash point | 308.776°C (Cal.) |
| Refractive index | 1.552 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[1-Cyclohexyl-2-(Cyclohexylamino)-2-Oxoethyl]-N-Propylbenzamide |