|
CAS#: 18922-13-9 Product: Diethylstilbestrol Pinacolone No suppilers available for the product. |
| Name | Diethylstilbestrol Pinacolone |
|---|---|
| Synonyms | Nsc 408851; 3-Hexanone, 4,4-Bis(4-Hydroxyphenyl)-; Nsc408851 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 |
| CAS Registry Number | 18922-13-9 |
| SMILES | C2=C(C(C1=CC=C(O)C=C1)(C(=O)CC)CC)C=CC(=C2)O |
| InChI | 1S/C18H20O3/c1-3-17(21)18(4-2,13-5-9-15(19)10-6-13)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3 |
| InChIKey | VXQMNZNWFJLHAO-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.569°C at 760 mmHg (Cal.) |
| Flash point | 247.069°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethylstilbestrol Pinacolone |