|
CAS#: 1897-96-7 Product: 3-(4-Ethoxyphenyl)-2-methyl-4-quinazolinone No suppilers available for the product. |
| Name | 3-(4-Ethoxyphenyl)-2-methyl-4-quinazolinone |
|---|---|
| Synonyms | 3-(4-Ethoxyphenyl)-2-Methyl-Quinazolin-4-One; 3-(4-Ethoxyphenyl)-2-Methyl-4-Quinazolinone; Brn 0255500 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 |
| CAS Registry Number | 1897-96-7 |
| SMILES | C3=C(N2C(C1=C(C=CC=C1)N=C2C)=O)C=CC(=C3)OCC |
| InChI | 1S/C17H16N2O2/c1-3-21-14-10-8-13(9-11-14)19-12(2)18-16-7-5-4-6-15(16)17(19)20/h4-11H,3H2,1-2H3 |
| InChIKey | JKWBQCHTVBSJDC-UHFFFAOYSA-N |
| Density | 1.176g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.141°C at 760 mmHg (Cal.) |
| Flash point | 230.876°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Ethoxyphenyl)-2-methyl-4-quinazolinone |