Online Database of Chemicals from Around the World
|
CAS#: 190-07-8 Product: Benzo(a)phenaleno(1,9-hi)acridine No suppilers available for the product. |
| Name | Benzo(a)phenaleno(1,9-hi)acridine |
|---|---|
| Synonyms | Benzo(A)Phenaleno(1,9-Hi)Acridine; Benzo(C)Phenaleno(1,9-I,J)Acridine |
| Molecular Structure |  |
| Molecular Formula | C27H15N |
| Molecular Weight | 353.42 |
| CAS Registry Number | 190-07-8 |
| SMILES | C1=C6C(=NC2=C1C=C5C3=C2C=CC4=C3C(=CC=C4)C=C5)C=CC7=CC=CC=C67 |
| InChI | 1S/C27H15N/c1-2-7-21-16(4-1)11-13-24-23(21)15-20-14-19-9-8-17-5-3-6-18-10-12-22(27(20)28-24)26(19)25(17)18/h1-15H |
| InChIKey | PMWBXWGVEXJWEF-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 638.299°C at 760 mmHg (Cal.) |
| Flash point | 283.393°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo(a)phenaleno(1,9-hi)acridine |