|
CAS#: 1902-25-6 Product: Phosphorothioic Acid O-[4-(Aminosulfonyl)Phenyl] O,O-Diethyl Ester No suppilers available for the product. |
| Name | Phosphorothioic Acid O-[4-(Aminosulfonyl)Phenyl] O,O-Diethyl Ester |
|---|---|
| Synonyms | 4-Diethoxythiophosphoryloxybenzenesulfonamide; Ac 26,095-2; Ai3-25639 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16NO5PS2 |
| Molecular Weight | 325.33 |
| CAS Registry Number | 1902-25-6 |
| SMILES | C1=C([S](=O)(=O)N)C=CC(=C1)O[P](=S)(OCC)OCC |
| InChI | 1S/C10H16NO5PS2/c1-3-14-17(18,15-4-2)16-9-5-7-10(8-6-9)19(11,12)13/h5-8H,3-4H2,1-2H3,(H2,11,12,13) |
| InChIKey | AREISRHESIVGTH-UHFFFAOYSA-N |
| Density | 1.375g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.69°C at 760 mmHg (Cal.) |
| Flash point | 214.274°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphorothioic Acid O-[4-(Aminosulfonyl)Phenyl] O,O-Diethyl Ester |