|
CAS#: 19028-72-9 Product: 6-[(Cyclohexylamino)Methylene]-2,4-Cyclohexadien-1-One No suppilers available for the product. |
| Name | 6-[(Cyclohexylamino)Methylene]-2,4-Cyclohexadien-1-One |
|---|---|
| Synonyms | NSC128046; ZINC00494437 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 |
| CAS Registry Number | 19028-72-9 |
| SMILES | O=C\2C(=CNC1CCCCC1)\C=C/C=C/2 |
| InChI | 1S/C13H17NO/c15-13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12/h4-6,9-10,12,14H,1-3,7-8H2 |
| InChIKey | VKVLHVFZYQRATE-UHFFFAOYSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.215°C at 760 mmHg (Cal.) |
| Flash point | 139.491°C (Cal.) |
| Refractive index | 1.556 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-[(Cyclohexylamino)Methylene]-2,4-Cyclohexadien-1-One |