|
CAS#: 19038-39-2 Product: 3-Ethyl-3-(P-Nitrophenyl)Azetidin-2-One No suppilers available for the product. |
| Name | 3-Ethyl-3-(P-Nitrophenyl)Azetidin-2-One |
|---|---|
| Synonyms | 3-Ethyl-3-(4-Nitrophenyl)-2-Azetidinone; 2-Azetidinone, 3-Ethyl-3-(P-Nitrophenyl)-; 3-Ethyl-3-(P-Nitrophenyl)-2-Azetidinone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 |
| CAS Registry Number | 19038-39-2 |
| SMILES | C2=C(C1(C(=O)NC1)CC)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C11H12N2O3/c1-2-11(7-12-10(11)14)8-3-5-9(6-4-8)13(15)16/h3-6H,2,7H2,1H3,(H,12,14) |
| InChIKey | MASZTUYKDGLQNB-UHFFFAOYSA-N |
| Density | 1.255g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.901°C at 760 mmHg (Cal.) |
| Flash point | 218.635°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-3-(P-Nitrophenyl)Azetidin-2-One |