|
CAS#: 19050-48-7 Product: 2,3,5,6-Tetrachloro-4-(Propylthio)Pyridine No suppilers available for the product. |
| Name | 2,3,5,6-Tetrachloro-4-(Propylthio)Pyridine |
|---|---|
| Synonyms | 2,3,5,6-Tetrachloro-4-Propylsulfanyl-Pyridine; 2,3,5,6-Tetrachloro-4-(Propylthio)Pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7Cl4NS |
| Molecular Weight | 291.02 |
| CAS Registry Number | 19050-48-7 |
| EINECS | 242-787-5 |
| SMILES | C(SC1=C(C(=NC(=C1Cl)Cl)Cl)Cl)CC |
| InChI | 1S/C8H7Cl4NS/c1-2-3-14-6-4(9)7(11)13-8(12)5(6)10/h2-3H2,1H3 |
| InChIKey | SFZLAIOIVCOPBG-UHFFFAOYSA-N |
| Density | 1.525g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.987°C at 760 mmHg (Cal.) |
| Flash point | 148.533°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,6-Tetrachloro-4-(Propylthio)Pyridine |