|
CAS#: 19071-62-6 Product: N-(alpha-(Chloromethyl)Phenethyl)-Benzamide No suppilers available for the product. |
| Name | N-(alpha-(Chloromethyl)Phenethyl)-Benzamide |
|---|---|
| Synonyms | N-[1-(Chloromethyl)-2-Phenyl-Ethyl]Benzamide; N-[1-(Chloromethyl)-2-Phenylethyl]Benzamide; N-[1-(Benzyl)-2-Chloro-Ethyl]Benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 |
| CAS Registry Number | 19071-62-6 |
| SMILES | C2=C(C(=O)NC(CC1=CC=CC=C1)CCl)C=CC=C2 |
| InChI | 1S/C16H16ClNO/c17-12-15(11-13-7-3-1-4-8-13)18-16(19)14-9-5-2-6-10-14/h1-10,15H,11-12H2,(H,18,19) |
| InChIKey | PPDXKKJMVOBAND-UHFFFAOYSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.195°C at 760 mmHg (Cal.) |
| Flash point | 245.423°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(alpha-(Chloromethyl)Phenethyl)-Benzamide |