|
CAS#: 19079-11-9 Product: 2,3-Dihydro-2-Methyl-3-Methylenepyrazino[1,2-a]Indole-1,4-Dione No suppilers available for the product. |
| Name | 2,3-Dihydro-2-Methyl-3-Methylenepyrazino[1,2-a]Indole-1,4-Dione |
|---|---|
| Synonyms | 2-Methyl-3-Methylene-Pyrazino[4,3-A]Indole-1,4-Dione; 2-Methyl-3-Methylenepyrazino[4,3-A]Indole-1,4-Dione; 2-Methyl-3-Methylene-Pyrazino[4,3-A]Indole-1,4-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 19079-11-9 |
| SMILES | C1=CC2=C(C=C1)C=C3[N]2C(=O)C(N(C)C3=O)=C |
| InChI | 1S/C13H10N2O2/c1-8-12(16)15-10-6-4-3-5-9(10)7-11(15)13(17)14(8)2/h3-7H,1H2,2H3 |
| InChIKey | SYXZMNNRTIHJKB-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.585°C at 760 mmHg (Cal.) |
| Flash point | 156.756°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-2-Methyl-3-Methylenepyrazino[1,2-a]Indole-1,4-Dione |