Online Database of Chemicals from Around the World
|
CAS#: 190841-58-8 Product: 3,3'-Bis(Trimethylsilyl)-1,1'-Binaphthalene-2,2'-Dithiol No suppilers available for the product. |
| Name | 3,3'-Bis(Trimethylsilyl)-1,1'-Binaphthalene-2,2'-Dithiol |
|---|---|
| Synonyms | [1,1'-BINAPHTHALENE]-2,2'-DITHIOL,3,3'-BIS(TRIMETHYLSILYL)- |
| Molecular Structure |  |
| Molecular Formula | C26H30S2Si2 |
| Molecular Weight | 462.82 |
| CAS Registry Number | 190841-58-8 |
| SMILES | Sc2c(cc1c(cccc1)c2c4c3ccccc3cc(c4S)[Si](C)(C)C)[Si](C)(C)C |
| InChI | 1S/C26H30S2Si2/c1-29(2,3)21-15-17-11-7-9-13-19(17)23(25(21)27)24-20-14-10-8-12-18(20)16-22(26(24)28)30(4,5)6/h7-16,27-28H,1-6H3 |
| InChIKey | NQCHTVIWYPODAH-UHFFFAOYSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.631°C at 760 mmHg (Cal.) |
| Flash point | 274.716°C (Cal.) |
| Refractive index | 1.634 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Bis(Trimethylsilyl)-1,1'-Binaphthalene-2,2'-Dithiol |