Online Database of Chemicals from Around the World
|
CAS#: 191-81-1 Product: Dibenzo[a,n]Perylene No suppilers available for the product. |
| Name | Dibenzo[a,n]Perylene |
|---|---|
| Synonyms | Dibenzoperylene; Dibenzo(A,N)Perylene |
| Molecular Structure | ![CAS#: 191-81-1, Dibenzo[a,n]Perylene](/moreStructures/191-81-1.gif) |
| Molecular Formula | C28H16 |
| Molecular Weight | 352.43 |
| CAS Registry Number | 191-81-1 |
| SMILES | C1=CC=CC2=C1C5=C4C(=C2)C=C3C=CC=CC3=C4C6=CC=CC7=CC=CC5=C67 |
| InChI | 1S/C28H16/c1-3-11-21-18(7-1)15-20-16-19-8-2-4-12-22(19)28-24-14-6-10-17-9-5-13-23(25(17)24)27(21)26(20)28/h1-16H |
| InChIKey | LUNAYPYLUWMUNY-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 629.299°C at 760 mmHg (Cal.) |
| Flash point | 330.53°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzo[a,n]Perylene |