|
CAS#: 1910-36-7 Product: N-Hydroxy-4-(Methylamino)Azobenzene No suppilers available for the product. |
| Name | N-Hydroxy-4-(Methylamino)Azobenzene |
|---|---|
| Synonyms | N-Methyl-N-(4-Phenylazophenyl)Hydroxylamine; Brn 1842449; Benzenamine, N-Hydroxy-N-Methyl-4-(Phenylazo)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 |
| CAS Registry Number | 1910-36-7 |
| SMILES | C1=C(N(C)O)C=CC(=C1)N=NC2=CC=CC=C2 |
| InChI | 1S/C13H13N3O/c1-16(17)13-9-7-12(8-10-13)15-14-11-5-3-2-4-6-11/h2-10,17H,1H3 |
| InChIKey | QZCFCYBJIPGALJ-UHFFFAOYSA-N |
| Density | 1.128g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.907°C at 760 mmHg (Cal.) |
| Flash point | 195.657°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Hydroxy-4-(Methylamino)Azobenzene |