|
CAS#: 19103-10-7 Product: (E)-1-(2-Isopropylphenyl)-N,1-Diphenylmethanimine No suppilers available for the product. |
| Name | (E)-1-(2-Isopropylphenyl)-N,1-Diphenylmethanimine |
|---|---|
| Synonyms | Benzenamine, N-[[2-(1-methylethyl)phenyl]phenylmethylene]-; N-[(E)-(2-Isopropylphenyl)(phenyl)methylidene]aniline # |
| Molecular Structure | ![]() |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.41 |
| CAS Registry Number | 19103-10-7 |
| SMILES | N(=C(/c1ccccc1C(C)C)c2ccccc2)\c3ccccc3 |
| InChI | 1S/C22H21N/c1-17(2)20-15-9-10-16-21(20)22(18-11-5-3-6-12-18)23-19-13-7-4-8-14-19/h3-17H,1-2H3/b23-22+ |
| InChIKey | LMSDXYUNBIPAPO-GHVJWSGMSA-N |
| Density | 0.984g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.21°C at 760 mmHg (Cal.) |
| Flash point | 193.813°C (Cal.) |
| Refractive index | 1.564 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-1-(2-Isopropylphenyl)-N,1-Diphenylmethanimine |