|
CAS#: 1913-28-6 Product: 11,19-Epoxypregn-4-Ene-3,20-Dione No suppilers available for the product. |
| Name | 11,19-Epoxypregn-4-Ene-3,20-Dione |
|---|---|
| Synonyms | 11,19-oxidoprogesterone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 |
| CAS Registry Number | 1913-28-6 |
| SMILES | CC(=O)[C@H]5CC[C@@H]1[C@]5(C)CC2OC[C@]43CCC(=O)/C=C4/CC[C@@H]1[C@H]23 |
| InChI | 1S/C21H28O3/c1-12(22)16-5-6-17-15-4-3-13-9-14(23)7-8-21(13)11-24-18(19(15)21)10-20(16,17)2/h9,15-19H,3-8,10-11H2,1-2H3/t15-,16+,17-,18?,19+,20+,21+/m0/s1 |
| InChIKey | OXOOIWULQIFUDQ-SLGDTRQESA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.531°C at 760 mmHg (Cal.) |
| Flash point | 216.786°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11,19-Epoxypregn-4-Ene-3,20-Dione |