|
CAS#: 19137-96-3 Product: 3-(1-Benzyl-2-Pyrrolidinyl)-1H-Indole No suppilers available for the product. |
| Name | 3-(1-Benzyl-2-Pyrrolidinyl)-1H-Indole |
|---|---|
| Synonyms | 3-[1-(Phenylmethyl)-2-Pyrrolidinyl]-1H-Indole; 3-[1-(Benzyl)Pyrrolidin-2-Yl]-1H-Indole; Brn 0537893 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 |
| CAS Registry Number | 19137-96-3 |
| SMILES | C3=C(C2N(CC1=CC=CC=C1)CCC2)C4=C([NH]3)C=CC=C4 |
| InChI | 1S/C19H20N2/c1-2-7-15(8-3-1)14-21-12-6-11-19(21)17-13-20-18-10-5-4-9-16(17)18/h1-5,7-10,13,19-20H,6,11-12,14H2 |
| InChIKey | UORKEUUXJMNISC-UHFFFAOYSA-N |
| Density | 1.178g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.612°C at 760 mmHg (Cal.) |
| Flash point | 223.298°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1-Benzyl-2-Pyrrolidinyl)-1H-Indole |