|
CAS#: 19155-54-5 Product: N,N,2-Trimethyl-2-Nitro-1-Propanamine No suppilers available for the product. |
| Name | N,N,2-Trimethyl-2-Nitro-1-Propanamine |
|---|---|
| Synonyms | N,N,2-Trimethyl-2-Nitro-Propan-1-Amine; Dimethyl-(2-Methyl-2-Nitro-Propyl)Amine; 1-Propanamine, N,N,2-Trimethyl-2-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 |
| CAS Registry Number | 19155-54-5 |
| SMILES | C(C([N+]([O-])=O)(C)C)N(C)C |
| InChI | 1S/C6H14N2O2/c1-6(2,8(9)10)5-7(3)4/h5H2,1-4H3 |
| InChIKey | NAOOJIDHHYTBND-UHFFFAOYSA-N |
| Density | 0.99g/cm3 (Cal.) |
|---|---|
| Boiling point | 183.091°C at 760 mmHg (Cal.) |
| Flash point | 64.531°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,2-Trimethyl-2-Nitro-1-Propanamine |