|
CAS#: 1916-63-8 Product: Phenoxazinone No suppilers available for the product. |
| Name | Phenoxazinone |
|---|---|
| Synonyms | 3-Phenoxazinone; 3H-Phenoxazin-3-One; Phenoxazinone |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7NO2 |
| Molecular Weight | 197.19 |
| CAS Registry Number | 1916-63-8 |
| SMILES | C1=CC=CC3=C1OC2=CC(=O)C=CC2=N3 |
| InChI | 1S/C12H7NO2/c14-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)13-10/h1-7H |
| InChIKey | UOMHBFAJZRZNQD-UHFFFAOYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.091°C at 760 mmHg (Cal.) |
| Flash point | 161.466°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phenoxazinone |