|
CAS#: 191668-10-7 Product: Ethyl 4-(4-Fluorophenyl)-1H-Pyrrole-3-Carboxylate No suppilers available for the product. |
| Name | Ethyl 4-(4-Fluorophenyl)-1H-Pyrrole-3-Carboxylate |
|---|---|
| Synonyms | 1H-Pyrrol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 |
| CAS Registry Number | 191668-10-7 |
| SMILES | CCOC(=O)c1c[nH]cc1c2ccc(cc2)F |
| InChI | 1S/C13H12FNO2/c1-2-17-13(16)12-8-15-7-11(12)9-3-5-10(14)6-4-9/h3-8,15H,2H2,1H3 |
| InChIKey | ZLCKIMSOPFAJGO-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.7±40.0°C at 760 mmHg (Cal.) |
| Flash point | 210.7±27.3°C (Cal.) |
| Refractive index | 1.557 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-(4-Fluorophenyl)-1H-Pyrrole-3-Carboxylate |