|
CAS#: 1919-38-6 Product: 7-(2-Chloropropyl)-3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 7-(2-Chloropropyl)-3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione |
|---|---|
| Synonyms | 7-(2-Chloropropyl)-1,3-Dimethyl-Purine-2,6-Dione; 7-(2-Chloropropyl)-1,3-Dimethyl-Xanthine; 7-(2-Chloropropyl)-3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 |
| CAS Registry Number | 1919-38-6 |
| EINECS | 217-641-9 |
| SMILES | C2=NC1=C(C(N(C(N1C)=O)C)=O)[N]2CC(Cl)C |
| InChI | 1S/C10H13ClN4O2/c1-6(11)4-15-5-12-8-7(15)9(16)14(3)10(17)13(8)2/h5-6H,4H2,1-3H3 |
| InChIKey | YAPLUWBOORSOHV-UHFFFAOYSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.508°C at 760 mmHg (Cal.) |
| Flash point | 229.888°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(2-Chloropropyl)-3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione |