|
CAS#: 191915-75-0 Product: 1,8-Acridinediol No suppilers available for the product. |
| Name | 1,8-Acridinediol |
|---|---|
| Synonyms | 1,8-Acridinediol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 |
| CAS Registry Number | 191915-75-0 |
| SMILES | c1cc2c(cc3c(n2)cccc3O)c(c1)O |
| InChI | 1S/C13H9NO2/c15-12-5-1-3-10-8(12)7-9-11(14-10)4-2-6-13(9)16/h1-7,15-16H |
| InChIKey | KCVHBJBCGXIYDS-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.898°C at 760 mmHg (Cal.) |
| Flash point | 250.082°C (Cal.) |
| Refractive index | 1.811 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Acridinediol |