|
CAS#: 19219-81-9 Product: 1,2,3-Trichloro-4,5,6-Trimethylbenzene No suppilers available for the product. |
| Name | 1,2,3-Trichloro-4,5,6-Trimethylbenzene |
|---|---|
| Synonyms | 1,2,3-Trichloro-4,5,6-Trimethyl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9Cl3 |
| Molecular Weight | 223.53 |
| CAS Registry Number | 19219-81-9 |
| SMILES | CC1=C(C(=C(C(=C1Cl)Cl)Cl)C)C |
| InChI | 1S/C9H9Cl3/c1-4-5(2)7(10)9(12)8(11)6(4)3/h1-3H3 |
| InChIKey | QCTIBRJBUAXXEB-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.703°C at 760 mmHg (Cal.) |
| Flash point | 203.933°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3-Trichloro-4,5,6-Trimethylbenzene |