|
CAS#: 19226-10-9 Product: 3,5-Diphenyl-1,3,4-Oxadiazol-2(3H)-One No suppilers available for the product. |
| Name | 3,5-Diphenyl-1,3,4-Oxadiazol-2(3H)-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.24 |
| CAS Registry Number | 19226-10-9 |
| SMILES | O=C2O\C(=N/N2c1ccccc1)c3ccccc3 |
| InChI | 1S/C14H10N2O2/c17-14-16(12-9-5-2-6-10-12)15-13(18-14)11-7-3-1-4-8-11/h1-10H |
| InChIKey | NCYKWHUYTOFYSY-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.553°C at 760 mmHg (Cal.) |
| Flash point | 160.971°C (Cal.) |
| Refractive index | 1.635 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Diphenyl-1,3,4-Oxadiazol-2(3H)-One |