|
CAS#: 19239-52-2 Product: Trichloroacetylphosphonic Acid Diethyl Ester No suppilers available for the product. |
| Name | Trichloroacetylphosphonic Acid Diethyl Ester |
|---|---|
| Synonyms | 2,2,2-Trichloro-1-Diethoxyphosphoryl-Ethanone; 4-02-00-00525 (Beilstein Handbook Reference); Brn 1790747 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10Cl3O4P |
| Molecular Weight | 283.48 |
| CAS Registry Number | 19239-52-2 |
| SMILES | C(O[P](C(=O)C(Cl)(Cl)Cl)(=O)OCC)C |
| InChI | 1S/C6H10Cl3O4P/c1-3-12-14(11,13-4-2)5(10)6(7,8)9/h3-4H2,1-2H3 |
| InChIKey | WDXGHPAMAUOFPM-UHFFFAOYSA-N |
| Density | 1.448g/cm3 (Cal.) |
|---|---|
| Boiling point | 257.849°C at 760 mmHg (Cal.) |
| Flash point | 119.563°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichloroacetylphosphonic Acid Diethyl Ester |