|
CAS#: 19244-22-5 Product: 4-Methyl-4-(4-Nitrophenyl)Tetrahydropyran-2,6-Dione No suppilers available for the product. |
| Name | 4-Methyl-4-(4-Nitrophenyl)Tetrahydropyran-2,6-Dione |
|---|---|
| Synonyms | 4-methyl-4-(4-nitrophenyl)-dihydro-3H-pyran-2,6-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 |
| CAS Registry Number | 19244-22-5 |
| SMILES | CC1(CC(=O)OC(=O)C1)c2ccc(cc2)[N+](=O)[O-] |
| InChI | 1S/C12H11NO5/c1-12(6-10(14)18-11(15)7-12)8-2-4-9(5-3-8)13(16)17/h2-5H,6-7H2,1H3 |
| InChIKey | HLQRSZCCNPGNON-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.748°C at 760 mmHg (Cal.) |
| Flash point | 210.353°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-4-(4-Nitrophenyl)Tetrahydropyran-2,6-Dione |