|
CAS#: 19257-34-2 Product: 3,3-Dimethoxyestr-5(10)-En-17-One No suppilers available for the product. |
| Name | 3,3-Dimethoxyestr-5(10)-En-17-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.45 |
| CAS Registry Number | 19257-34-2 |
| SMILES | C[C@@]12CC[C@@H]3C=4CCC(CC=4CC[C@H]3[C@@H]2CCC1=O)(OC)OC |
| InChI | 1S/C20H30O3/c1-19-10-8-15-14-9-11-20(22-2,23-3)12-13(14)4-5-16(15)17(19)6-7-18(19)21/h15-17H,4-12H2,1-3H3/t15-,16-,17+,19+/m1/s1 |
| InChIKey | RHMXJSWKQJYEOA-VXNCWWDNSA-N |
| Density | 1.109g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.059°C at 760 mmHg (Cal.) |
| Flash point | 200.815°C (Cal.) |
| Refractive index | 1.535 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dimethoxyestr-5(10)-En-17-One |