|
CAS#: 19262-20-5 Product: 1-(1,2,2-Trimethylpropyl)Benzene No suppilers available for the product. |
| Name | 1-(1,2,2-Trimethylpropyl)Benzene |
|---|---|
| Synonyms | 1,2,2-Trimethylpropylbenzene; (1,2,2-Trimethylpropyl)Benzene; Benzene, (1,2,2-Trimethylpropyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.27 |
| CAS Registry Number | 19262-20-5 |
| SMILES | C1=C(C(C(C)(C)C)C)C=CC=C1 |
| InChI | 1S/C12H18/c1-10(12(2,3)4)11-8-6-5-7-9-11/h5-10H,1-4H3 |
| InChIKey | UYOAOYYUSXVILM-UHFFFAOYSA-N |
| Density | 0.858g/cm3 (Cal.) |
|---|---|
| Boiling point | 202.286°C at 760 mmHg (Cal.) |
| Flash point | 67.208°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,2,2-Trimethylpropyl)Benzene |