|
CAS#: 19275-09-3 Product: 3-Phenyl-Naphtho[2,3-d]-V-Triazin-4(3H)-One No suppilers available for the product. |
| Name | 3-Phenyl-Naphtho[2,3-d]-V-Triazin-4(3H)-One |
|---|---|
| Synonyms | 3-Phenyl-4-Benzo[G][1,2,3]Benzotriazinone; Naphtho[2,3-D]-V-Triazin-4(3H)-One, 3-Phenyl-; Naphtho(2,3-E)-4-Hydro-4-Oxo-3-Phenyl-1,2,3-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H11N3O |
| Molecular Weight | 273.29 |
| CAS Registry Number | 19275-09-3 |
| SMILES | C1=C4C(=CC2=C1C(=O)N(N=N2)C3=CC=CC=C3)C=CC=C4 |
| InChI | 1S/C17H11N3O/c21-17-15-10-12-6-4-5-7-13(12)11-16(15)18-19-20(17)14-8-2-1-3-9-14/h1-11H |
| InChIKey | OHHFEIRDCKETFR-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.362°C at 760 mmHg (Cal.) |
| Flash point | 237.662°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Phenyl-Naphtho[2,3-d]-V-Triazin-4(3H)-One |