|
CAS#: 1929-86-8 Product: Potassium 2-(4-Chloro-2-Methylphenoxy)Propionate No suppilers available for the product. |
| Name | Potassium 2-(4-Chloro-2-Methylphenoxy)Propionate |
|---|---|
| Synonyms | Potassium 2-(4-Chloro-2-Methyl-Phenoxy)Propanoate; Potassium 2-(4-Chloro-2-Methyl-Phenoxy)Propionate; Mecoprop Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClKO3 |
| Molecular Weight | 252.74 |
| CAS Registry Number | 1929-86-8 |
| EINECS | 217-683-8 |
| SMILES | C1=C(C=CC(=C1C)OC(C(=O)[O-])C)Cl.[K+] |
| InChI | 1S/C10H11ClO3.K/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;/h3-5,7H,1-2H3,(H,12,13);/q;+1/p-1 |
| InChIKey | OFCQYQOZASISIU-UHFFFAOYSA-M |
| Boiling point | 331.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 154.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 2-(4-Chloro-2-Methylphenoxy)Propionate |