| Name | [1,3-Phenylenebis(Methylene)]Bis(Diisopropylphosphine) |
|---|---|
| Synonyms | (3-[(Diis |
| Molecular Structure | ![]() |
| Molecular Formula | C20H36P2 |
| Molecular Weight | 338.45 |
| CAS Registry Number | 193084-64-9 |
| SMILES | P(C(C)C)(Cc1cccc(c1)CP(C(C)C)C(C)C)C(C)C |
| InChI | 1S/C20H36P2/c1-15(2)21(16(3)4)13-19-10-9-11-20(12-19)14-22(17(5)6)18(7)8/h9-12,15-18H,13-14H2,1-8H3 |
| InChIKey | RCZCQFVLSKYTSN-UHFFFAOYSA-N |
| Boiling point | 419.808°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 219.452°C (Cal.) |
| Refractive index | (Cal.) |
| (1) | Cristóbal Melero, Luis M. Martínez-Prieto, Pilar Palma, Diego del Rio, Eleuterio Álvarez and Juan Cámpora. Selective reduction of a Pd pincer PCP complex to well-defined Pd(0) species, Chem. Commun., 2010, 46, 8851. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for [1,3-Phenylenebis(Methylene)]Bis(Diisopropylphosphine) |