|
CAS#: 1931-61-9 Product: Di(Tert-Butyl) Methyldiperoxysuccinate No suppilers available for the product. |
| Name | Di(Tert-Butyl) Methyldiperoxysuccinate |
|---|---|
| Synonyms | 2-Methylbutanediperoxoic Acid Ditert-Butyl Ester; 2-Methylperoxysuccinic Acid Ditert-Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 |
| CAS Registry Number | 1931-61-9 |
| EINECS | 217-690-6 |
| SMILES | C(C(OOC(C)(C)C)=O)C(C(OOC(C)(C)C)=O)C |
| InChI | 1S/C13H24O6/c1-9(11(15)17-19-13(5,6)7)8-10(14)16-18-12(2,3)4/h9H,8H2,1-7H3 |
| InChIKey | VEOMCUUTIYXSLV-UHFFFAOYSA-N |
| Density | 1.05g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.983°C at 760 mmHg (Cal.) |
| Flash point | 126.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di(Tert-Butyl) Methyldiperoxysuccinate |