|
CAS#: 19340-14-8 Product: Keto-[(1-phenyl-4-pyridylidene)methyl]ammonium chloride No suppilers available for the product. |
| Name | Keto-[(1-phenyl-4-pyridylidene)methyl]ammonium chloride |
|---|---|
| Synonyms | Oxo-[(1-Phenyl-4-Pyridylidene)Methyl]Ammonium Chloride; Keto-[(1-Phenyl-4-Pyridylidene)Methyl]Ammonium Chloride; Chlorure De 1 Phenyle De Pyridine 4-Aldoxime [French] |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.68 |
| CAS Registry Number | 19340-14-8 |
| SMILES | C2=C(N1C=CC(C=C1)=C[NH+]=O)C=CC=C2.[Cl-] |
| InChI | 1S/C12H10N2O.ClH/c15-13-10-11-6-8-14(9-7-11)12-4-2-1-3-5-12;/h1-10H;1H |
| InChIKey | OUVXTINDNVCUCI-UHFFFAOYSA-N |
| Boiling point | 291.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 130.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Keto-[(1-phenyl-4-pyridylidene)methyl]ammonium chloride |