| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | p-Toluenesulfonic Acid N'-(3-Pyridinylmethylene) Hydrazide |
|---|---|
| Synonyms | 4-Methyl-N-(3-Pyridylmethyleneamino)Benzenesulfonamide; Smr000186095; Nsc263849 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.32 |
| CAS Registry Number | 19350-76-6 |
| SMILES | C2=C([S](N\N=C\C1=CC=CN=C1)(=O)=O)C=CC(=C2)C |
| InChI | 1S/C13H13N3O2S/c1-11-4-6-13(7-5-11)19(17,18)16-15-10-12-3-2-8-14-9-12/h2-10,16H,1H3/b15-10+ |
| InChIKey | PMQPVPKXDUISEM-XNTDXEJSSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.46°C at 760 mmHg (Cal.) |
| Flash point | 228.649°C (Cal.) |
| (1) | Barluenga et al.. A metal-free carbon-carbon bond-forming reductive coupling between boronic acids and tosylhydrazones, Nature Chemistry, 2009 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for p-Toluenesulfonic Acid N'-(3-Pyridinylmethylene) Hydrazide |