|
CAS#: 19372-01-1 Product: Diethyl (Z)-2-Bromobut-2-Enedioate No suppilers available for the product. |
| Name | Diethyl (Z)-2-Bromobut-2-Enedioate |
|---|---|
| Synonyms | (Z)-2-Bromobut-2-Enedioic Acid Diethyl Ester; 2-Butenedioic Acid, 2-Bromo-, Diethyl Ester, (Z)-; Diethyl 2-Bromofumarate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11BrO4 |
| Molecular Weight | 251.08 |
| CAS Registry Number | 19372-01-1 |
| SMILES | C(OC(/C(=C/C(=O)OCC)Br)=O)C |
| InChI | 1S/C8H11BrO4/c1-3-12-7(10)5-6(9)8(11)13-4-2/h5H,3-4H2,1-2H3/b6-5- |
| InChIKey | MNMKHOONIYTDRL-WAYWQWQTSA-N |
| Density | 1.442g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.766°C at 760 mmHg (Cal.) |
| Flash point | 115.741°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl (Z)-2-Bromobut-2-Enedioate |