Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | (2,3,4,5,6-Pentachlorophenyl)sulfanylcarbothioyl dimethylaminomethanedithioate |
|---|---|
| Synonyms | Dimethylaminomethanedithioic Acid [[(2,3,4,5,6-Pentachlorophenyl)Thio]-Thioxomethyl] Ester; Dimethylaminomethanedithioic Acid [(2,3,4,5,6-Pentachlorophenyl)Thio]Carbothioyl Ester; Nsc313977 |
| Molecular Structure |  |
| Molecular Formula | C10H6Cl5NS4 |
| Molecular Weight | 445.67 |
| CAS Registry Number | 19378-05-3 |
| SMILES | CN(C)C(SC(SC1=C(Cl)C(=C(Cl)C(=C1Cl)Cl)Cl)=S)=S |
| InChI | 1S/C10H6Cl5NS4/c1-16(2)9(17)20-10(18)19-8-6(14)4(12)3(11)5(13)7(8)15/h1-2H3 |
| InChIKey | UXBNOOUEHRPLEN-UHFFFAOYSA-N |
| Density | 1.741g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.622°C at 760 mmHg (Cal.) |
| Flash point | 251.729°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,3,4,5,6-Pentachlorophenyl)sulfanylcarbothioyl dimethylaminomethanedithioate |