|
CAS#: 19384-00-0 Product: 2-Azulenol No suppilers available for the product. |
| Name | 2-Azulenol |
|---|---|
| Synonyms | 2-hydroxyazulene; InChI=1/C10H8O/c11-10-6-8-4-2-1-3-5-9(8)7-10/h1-7,11H |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8O |
| Molecular Weight | 144.17 |
| CAS Registry Number | 19384-00-0 |
| SMILES | C1=CC=C2C=C(C=C2C=C1)O |
| InChI | 1S/C10H8O/c11-10-6-8-4-2-1-3-5-9(8)7-10/h1-7,11H |
| InChIKey | RKMKWDVUTHKNMU-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.1±9.0°C at 760 mmHg (Cal.) |
| Flash point | 143.5±10.6°C (Cal.) |
| Refractive index | 1.678 (Cal.) |
| (1) | Ryuji Yokoyama, Shunji Ito, Masataka Watanabe, Nobuyuki Harada, Chizuko Kabuto and Noboru Morita. [2 + 2] Cycloaddition reaction of cycloheptatriene with dichloroketene. A novel and efficient synthetic strategy for the synthesis of 2-hydroxyazulene, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 2257. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Azulenol |