|
CAS#: 19386-45-9 Product: 2,3,5-Trichloro-6-[(3,4,6-Trichloro-2-Hydroxy-Phenyl)Methyl]Phenol No suppilers available for the product. |
| Name | 2,3,5-Trichloro-6-[(3,4,6-Trichloro-2-Hydroxy-Phenyl)Methyl]Phenol |
|---|---|
| Synonyms | 2,3,5-Trichloro-6-[(3,4,6-Trichloro-2-Hydroxy-Phenyl)Methyl]Phenol; 2,3,5-Trichloro-6-(3,4,6-Trichloro-2-Hydroxy-Benzyl)Phenol; Phenol, 2,2'-Methylenebis(3,5,6-Trichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H6Cl6O2 |
| Molecular Weight | 406.91 |
| CAS Registry Number | 19386-45-9 |
| SMILES | C1=C(Cl)C(=C(O)C(=C1Cl)Cl)CC2=C(Cl)C=C(Cl)C(=C2O)Cl |
| InChI | 1S/C13H6Cl6O2/c14-6-2-8(16)10(18)12(20)4(6)1-5-7(15)3-9(17)11(19)13(5)21/h2-3,20-21H,1H2 |
| InChIKey | SPFVBVIRMDLUJI-UHFFFAOYSA-N |
| Density | 1.714g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.557°C at 760 mmHg (Cal.) |
| Flash point | 234.756°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5-Trichloro-6-[(3,4,6-Trichloro-2-Hydroxy-Phenyl)Methyl]Phenol |