|
CAS#: 19396-77-1 Product: 3,5-Diacetyl-2,6-Dimethyl-4H-Pyran-4-One No suppilers available for the product. |
| Name | 3,5-Diacetyl-2,6-Dimethyl-4H-Pyran-4-One |
|---|---|
| Synonyms | 3,5-Diacetyl-2,6-dimethyl-4H-pyran-4-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 19396-77-1 |
| SMILES | O=C(C=1C(=O)/C(=C(\OC=1C)C)C(=O)C)C |
| InChI | 1S/C11H12O4/c1-5(12)9-7(3)15-8(4)10(6(2)13)11(9)14/h1-4H3 |
| InChIKey | XFJIXARLDYKCPG-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.642°C at 760 mmHg (Cal.) |
| Flash point | 186.418°C (Cal.) |
| Refractive index | 1.504 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Diacetyl-2,6-Dimethyl-4H-Pyran-4-One |