Online Database of Chemicals from Around the World
| Name | 6-(2-Hydroxy-3,5,6-Trichlorobenzyl)-2,3,4-Trichlorophenol |
|---|---|
| Synonyms | 2,3,4-Trichloro-6-[(2,3,5-Trichloro-6-Hydroxy-Phenyl)Methyl]Phenol; 2,3,4-Trichloro-6-(2,3,5-Trichloro-6-Hydroxy-Benzyl)Phenol; Phenol, 3,4,4',5',6,6'-Hexachloro-2,2'-Methylenedi- |
| Molecular Structure |  |
| Molecular Formula | C13H6Cl6O2 |
| Molecular Weight | 406.91 |
| CAS Registry Number | 1940-20-1 |
| SMILES | C1=C(C(=C(Cl)C(=C1CC2=C(O)C(=CC(=C2Cl)Cl)Cl)O)Cl)Cl |
| InChI | 1S/C13H6Cl6O2/c14-6-2-4(12(20)11(19)10(6)18)1-5-9(17)7(15)3-8(16)13(5)21/h2-3,20-21H,1H2 |
| InChIKey | KZMAWKHGXPFBSI-UHFFFAOYSA-N |
| Density | 1.714g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.728°C at 760 mmHg (Cal.) |
| Flash point | 240.907°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(2-Hydroxy-3,5,6-Trichlorobenzyl)-2,3,4-Trichlorophenol |
